C25H40F2O — CID 54252028
2,2-difluoro-3-methyl-6-[4-[4-(4-methylcyclohex-3-en-1-yl)cyclohexyl]cyclohexyl]oxane (PubChem CID 54252028) has the molecular formula C25H40F2O and a molecular weight of 394.59 g/mol. Its IUPAC name is 2,2-difluoro-3-methyl-6-[4-[4-(4-methylcyclohex-3-en-1-yl)cyclohexyl]cyclohexyl]oxane.
| Compound Name | 2,2-difluoro-3-methyl-6-[4-[4-(4-methylcyclohex-3-en-1-yl)cyclohexyl]cyclohexyl]oxane |
|---|---|
| PubChem CID | 54252028 |
| Molecular Formula | C25H40F2O |
| Molecular Weight | 394.59 g/mol |
| Exact Mass | 394.30 |
| IUPAC Name | 2,2-difluoro-3-methyl-6-[4-[4-(4-methylcyclohex-3-en-1-yl)cyclohexyl]cyclohexyl]oxane |
| SMILES | CC1=CCC(C2CCC(C3CCC(C4CCC(C)C(F)(F)O4)CC3)CC2)CC1 |
| InChI | InChI=1S/C25H40F2O/c1-17-3-6-19(7-4-17)20-8-10-21(11-9-20)22-12-14-23(15-13-22)24-16-5-18(2)25(26,27)28-24/h3,18-24H,4-16H2,1-2H3 |
| InChIKey | QXLGJAFHGYETOC-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.59 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|