C19H30F2O — CID 54280744
2,2-difluoro-3-methyl-6-[4-(4-methylcyclohex-3-en-1-yl)cyclohexyl]oxane (PubChem CID 54280744) has the molecular formula C19H30F2O and a molecular weight of 312.44 g/mol. Its IUPAC name is 2,2-difluoro-3-methyl-6-[4-(4-methylcyclohex-3-en-1-yl)cyclohexyl]oxane.
| Compound Name | 2,2-difluoro-3-methyl-6-[4-(4-methylcyclohex-3-en-1-yl)cyclohexyl]oxane |
|---|---|
| PubChem CID | 54280744 |
| Molecular Formula | C19H30F2O |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 2,2-difluoro-3-methyl-6-[4-(4-methylcyclohex-3-en-1-yl)cyclohexyl]oxane |
| SMILES | CC1=CCC(C2CCC(C3CCC(C)C(F)(F)O3)CC2)CC1 |
| InChI | InChI=1S/C19H30F2O/c1-13-3-6-15(7-4-13)16-8-10-17(11-9-16)18-12-5-14(2)19(20,21)22-18/h3,14-18H,4-12H2,1-2H3 |
| InChIKey | RQPPMEZFUCUMTH-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|