C23H38F2O — CID 20705534
1-[difluoro-(4-methylcyclohexyl)oxymethyl]-4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexane (PubChem CID 20705534) has the molecular formula C23H38F2O and a molecular weight of 368.55 g/mol. Its IUPAC name is 1-[difluoro-(4-methylcyclohexyl)oxymethyl]-4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexane.
| Compound Name | 1-[difluoro-(4-methylcyclohexyl)oxymethyl]-4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexane |
|---|---|
| PubChem CID | 20705534 |
| Molecular Formula | C23H38F2O |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | 1-[difluoro-(4-methylcyclohexyl)oxymethyl]-4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexane |
| SMILES | CC1CCC(/C=C/C2CCC(C(F)(F)OC3CCC(C)CC3)CC2)CC1 |
| InChI | InChI=1S/C23H38F2O/c1-17-3-7-19(8-4-17)9-10-20-11-13-21(14-12-20)23(24,25)26-22-15-5-18(2)6-16-22/h9-10,17-22H,3-8,11-16H2,1-2H3/b10-9+ |
| InChIKey | YSLXBGKCMSSYBO-MDZDMXLPSA-N |
| XLogP | 7.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|