C15H22F4O — CID 11055493
[(Z)-1-cyclohexyloxy-2,3,3,3-tetrafluoroprop-1-enyl]cyclohexane (PubChem CID 11055493) has the molecular formula C15H22F4O and a molecular weight of 294.33 g/mol. Its IUPAC name is [(Z)-1-cyclohexyloxy-2,3,3,3-tetrafluoroprop-1-enyl]cyclohexane.
| Compound Name | [(Z)-1-cyclohexyloxy-2,3,3,3-tetrafluoroprop-1-enyl]cyclohexane |
|---|---|
| PubChem CID | 11055493 |
| Molecular Formula | C15H22F4O |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | [(Z)-1-cyclohexyloxy-2,3,3,3-tetrafluoroprop-1-enyl]cyclohexane |
| SMILES | F/C(=C(\OC1CCCCC1)C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C15H22F4O/c16-14(15(17,18)19)13(11-7-3-1-4-8-11)20-12-9-5-2-6-10-12/h11-12H,1-10H2/b14-13- |
| InChIKey | YDHLSDNEHDBXGR-YPKPFQOOSA-N |
| XLogP | 5.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|