C12H21F3OSi — CID 11043721
[(E)-2-cyclohexyloxy-3,3,3-trifluoroprop-1-enyl]-trimethylsilane (PubChem CID 11043721) has the molecular formula C12H21F3OSi and a molecular weight of 266.38 g/mol. Its IUPAC name is [(E)-2-cyclohexyloxy-3,3,3-trifluoroprop-1-enyl]-trimethylsilane.
| Compound Name | [(E)-2-cyclohexyloxy-3,3,3-trifluoroprop-1-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 11043721 |
| Molecular Formula | C12H21F3OSi |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | [(E)-2-cyclohexyloxy-3,3,3-trifluoroprop-1-enyl]-trimethylsilane |
| SMILES | C[Si](C)(C)/C=C(/OC1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C12H21F3OSi/c1-17(2,3)9-11(12(13,14)15)16-10-7-5-4-6-8-10/h9-10H,4-8H2,1-3H3/b11-9+ |
| InChIKey | IXOPELMNOQHUOX-PKNBQFBNSA-N |
| XLogP | 4.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|