About 5,5-difluoro-4,4,6,7-tetramethyl-2,3-dihydrooxepine
5,5-difluoro-4,4,6,7-tetramethyl-2,3-dihydrooxepine (PubChem CID 155002223) has the molecular formula C10H16F2O
and a molecular weight of 190.23 g/mol. Its IUPAC name is 5,5-difluoro-4,4,6,7-tetramethyl-2,3-dihydrooxepine.
Analyze 5,5-difluoro-4,4,6,7-tetramethyl-2,3-dihydrooxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-difluoro-4,4,6,7-tetramethyl-2,3-dihydrooxepine?
The IUPAC name of 5,5-difluoro-4,4,6,7-tetramethyl-2,3-dihydrooxepine (CID 155002223) is 5,5-difluoro-4,4,6,7-tetramethyl-2,3-dihydrooxepine.
What is the SMILES notation for 5,5-difluoro-4,4,6,7-tetramethyl-2,3-dihydrooxepine?
The canonical SMILES for 5,5-difluoro-4,4,6,7-tetramethyl-2,3-dihydrooxepine is CC1=C(C)C(F)(F)C(C)(C)CCO1.
What is the InChIKey of 5,5-difluoro-4,4,6,7-tetramethyl-2,3-dihydrooxepine?
The InChIKey is XKJHRPRXPKCTLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F2O/c1-7-8(2)13-6-5-9(3,4)10(7,11)12/h5-6H2,1-4H3.
What are the key properties of 5,5-difluoro-4,4,6,7-tetramethyl-2,3-dihydrooxepine?
5,5-difluoro-4,4,6,7-tetramethyl-2,3-dihydrooxepine has a molecular weight of 190.23 g/mol, XLogP of 3.36, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-difluoro-4,4,6,7-tetramethyl-2,3-dihydrooxepine is sourced from PubChem (CID 155002223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).