C18H28F6O3 — CID 176591312
3,3,4,4,5,5-hexafluoro-1-[6-(5-methoxypentoxy)hexoxy]-2-methylcyclopentene (PubChem CID 176591312) has the molecular formula C18H28F6O3 and a molecular weight of 406.41 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1-[6-(5-methoxypentoxy)hexoxy]-2-methylcyclopentene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1-[6-(5-methoxypentoxy)hexoxy]-2-methylcyclopentene |
|---|---|
| PubChem CID | 176591312 |
| Molecular Formula | C18H28F6O3 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1-[6-(5-methoxypentoxy)hexoxy]-2-methylcyclopentene |
| SMILES | COCCCCCOCCCCCCOC1=C(C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C18H28F6O3/c1-14-15(17(21,22)18(23,24)16(14,19)20)27-13-9-4-3-7-11-26-12-8-5-6-10-25-2/h3-13H2,1-2H3 |
| InChIKey | YGVJXBRVDYWOJR-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|