C13H18F6O2 — CID 176591317
3,3,4,4,5,5-hexafluoro-1-(5-methoxy-3-methylpentoxy)-2-methylcyclopentene (PubChem CID 176591317) has the molecular formula C13H18F6O2 and a molecular weight of 320.27 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1-(5-methoxy-3-methylpentoxy)-2-methylcyclopentene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1-(5-methoxy-3-methylpentoxy)-2-methylcyclopentene |
|---|---|
| PubChem CID | 176591317 |
| Molecular Formula | C13H18F6O2 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1-(5-methoxy-3-methylpentoxy)-2-methylcyclopentene |
| SMILES | COCCC(C)CCOC1=C(C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C13H18F6O2/c1-8(4-6-20-3)5-7-21-10-9(2)11(14,15)13(18,19)12(10,16)17/h8H,4-7H2,1-3H3 |
| InChIKey | KWSAVMHIQCMZRD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|