C13H18F6O3 — CID 176591350
3,3,4,4,5,5-hexafluoro-1-[1-(1-methoxypropan-2-yloxy)propan-2-yloxy]-2-methylcyclopentene (PubChem CID 176591350) has the molecular formula C13H18F6O3 and a molecular weight of 336.27 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1-[1-(1-methoxypropan-2-yloxy)propan-2-yloxy]-2-methylcyclopentene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1-[1-(1-methoxypropan-2-yloxy)propan-2-yloxy]-2-methylcyclopentene |
|---|---|
| PubChem CID | 176591350 |
| Molecular Formula | C13H18F6O3 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1-[1-(1-methoxypropan-2-yloxy)propan-2-yloxy]-2-methylcyclopentene |
| SMILES | COCC(C)OCC(C)OC1=C(C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C13H18F6O3/c1-7(5-20-4)21-6-8(2)22-10-9(3)11(14,15)13(18,19)12(10,16)17/h7-8H,5-6H2,1-4H3 |
| InChIKey | ZBDHTXAWNLOPSK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|