C11HF19O — CID 167433157
3,3,4,4,5,5-hexafluoro-1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclopentene (PubChem CID 167433157) has the molecular formula C11HF19O and a molecular weight of 510.09 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclopentene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclopentene |
|---|---|
| PubChem CID | 167433157 |
| Molecular Formula | C11HF19O |
| Molecular Weight | 510.09 g/mol |
| Exact Mass | 509.97 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclopentene |
| SMILES | FC(F)(F)C(OC1=C(C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)C1(F)F)C(F)(F)F |
| InChI | InChI=1S/C11HF19O/c12-4(10(25,26)27,11(28,29)30)1-2(6(15,16)9(23,24)5(1,13)14)31-3(7(17,18)19)8(20,21)22/h3H |
| InChIKey | FHARJMBHKHMDJZ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.09 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|