C19H6F30O2 — CID 159149768
1,2-bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-3,3,4,4,5,5-hexafluorocyclopentene (PubChem CID 159149768) has the molecular formula C19H6F30O2 and a molecular weight of 836.19 g/mol. Its IUPAC name is 1,2-bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-3,3,4,4,5,5-hexafluorocyclopentene.
| Compound Name | 1,2-bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-3,3,4,4,5,5-hexafluorocyclopentene |
|---|---|
| PubChem CID | 159149768 |
| Molecular Formula | C19H6F30O2 |
| Molecular Weight | 836.19 g/mol |
| Exact Mass | 835.99 |
| IUPAC Name | 1,2-bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-3,3,4,4,5,5-hexafluorocyclopentene |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)COC1=C(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C19H6F30O2/c20-5(21)11(32,33)16(42,43)18(46,47)13(36,37)7(24,25)1-50-3-4(10(30,31)15(40,41)9(3,28)29)51-2-8(26,27)14(38,39)19(48,49)17(44,45)12(34,35)6(22)23/h5-6H,1-2H2 |
| InChIKey | KJCZMYUCUKUAND-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.19 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|