C31H48O7 — CID 159806604
(4-ethylphenyl) 4-methoxy-2-methylbutanoate;[4-(hydroxymethyl)phenyl] 2-(2-methoxyethyl)hexanoate;methane (PubChem CID 159806604) has the molecular formula C31H48O7 and a molecular weight of 532.72 g/mol. Its IUPAC name is (4-ethylphenyl) 4-methoxy-2-methylbutanoate;[4-(hydroxymethyl)phenyl] 2-(2-methoxyethyl)hexanoate;methane.
| Compound Name | (4-ethylphenyl) 4-methoxy-2-methylbutanoate;[4-(hydroxymethyl)phenyl] 2-(2-methoxyethyl)hexanoate;methane |
|---|---|
| PubChem CID | 159806604 |
| Molecular Formula | C31H48O7 |
| Molecular Weight | 532.72 g/mol |
| Exact Mass | 532.34 |
| IUPAC Name | (4-ethylphenyl) 4-methoxy-2-methylbutanoate;[4-(hydroxymethyl)phenyl] 2-(2-methoxyethyl)hexanoate;methane |
| SMILES | C.CCCCC(CCOC)C(=O)Oc1ccc(CO)cc1.CCc1ccc(OC(=O)C(C)CCOC)cc1 |
| InChI | InChI=1S/C16H24O4.C14H20O3.CH4/c1-3-4-5-14(10-11-19-2)16(18)20-15-8-6-13(12-17)7-9-15;1-4-12-5-7-13(8-6-12)17-14(15)11(2)9-10-16-3;/h6-9,14,17H,3-5,10-12H2,1-2H3;5-8,11H,4,9-10H2,1-3H3;1H4 |
| InChIKey | NKMACMHEPJNWME-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.72 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|