About 5-bromo-2-iodopyrimidine;5-bromo-2-phenylpyrimidine;phenylboronic acid
5-bromo-2-iodopyrimidine;5-bromo-2-phenylpyrimidine;phenylboronic acid (PubChem CID 159806978) has the molecular formula C20H16BBr2IN4O2
and a molecular weight of 641.90 g/mol. Its IUPAC name is 5-bromo-2-iodopyrimidine;5-bromo-2-phenylpyrimidine;phenylboronic acid.
Molecular Properties
| Compound Name | 5-bromo-2-iodopyrimidine;5-bromo-2-phenylpyrimidine;phenylboronic acid |
| PubChem CID | 159806978 |
| Molecular Formula | C20H16BBr2IN4O2 |
| Molecular Weight | 641.90 g/mol |
| Exact Mass | 639.88 |
| IUPAC Name | 5-bromo-2-iodopyrimidine;5-bromo-2-phenylpyrimidine;phenylboronic acid |
| SMILES | Brc1cnc(-c2ccccc2)nc1.Brc1cnc(I)nc1.OB(O)c1ccccc1 |
| InChI | InChI=1S/C10H7BrN2.C6H7BO2.C4H2BrIN2/c11-9-6-12-10(13-7-9)8-4-2-1-3-5-8;8-7(9)6-4-2-1-3-5-6;5-3-1-7-4(6)8-2-3/h1-7H;1-5,8-9H;1-2H |
| InChIKey | NKNGOVYYINHVFR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 641.90 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-iodopyrimidine;5-bromo-2-phenylpyrimidine;phenylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-iodopyrimidine;5-bromo-2-phenylpyrimidine;phenylboronic acid?
The IUPAC name of 5-bromo-2-iodopyrimidine;5-bromo-2-phenylpyrimidine;phenylboronic acid (CID 159806978) is 5-bromo-2-iodopyrimidine;5-bromo-2-phenylpyrimidine;phenylboronic acid.
What is the SMILES notation for 5-bromo-2-iodopyrimidine;5-bromo-2-phenylpyrimidine;phenylboronic acid?
The canonical SMILES for 5-bromo-2-iodopyrimidine;5-bromo-2-phenylpyrimidine;phenylboronic acid is Brc1cnc(-c2ccccc2)nc1.Brc1cnc(I)nc1.OB(O)c1ccccc1.
What is the InChIKey of 5-bromo-2-iodopyrimidine;5-bromo-2-phenylpyrimidine;phenylboronic acid?
The InChIKey is NKNGOVYYINHVFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrN2.C6H7BO2.C4H2BrIN2/c11-9-6-12-10(13-7-9)8-4-2-1-3-5-8;8-7(9)6-4-2-1-3-5-6;5-3-1-7-4(6)8-2-3/h1-7H;1-5,8-9H;1-2H.
What are the key properties of 5-bromo-2-iodopyrimidine;5-bromo-2-phenylpyrimidine;phenylboronic acid?
5-bromo-2-iodopyrimidine;5-bromo-2-phenylpyrimidine;phenylboronic acid has a molecular weight of 641.90 g/mol, XLogP of 4.12, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-iodopyrimidine;5-bromo-2-phenylpyrimidine;phenylboronic acid is sourced from PubChem (CID 159806978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).