C8H8N2O2S — CID 159808247
N-(2H-1,3-thiazol-3-yl)furan-2-carboxamide (PubChem CID 159808247) has the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. Its IUPAC name is N-(2H-1,3-thiazol-3-yl)furan-2-carboxamide.
| Compound Name | N-(2H-1,3-thiazol-3-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 159808247 |
| Molecular Formula | C8H8N2O2S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | N-(2H-1,3-thiazol-3-yl)furan-2-carboxamide |
| SMILES | O=C(NN1C=CSC1)c1ccco1 |
| InChI | InChI=1S/C8H8N2O2S/c11-8(7-2-1-4-12-7)9-10-3-5-13-6-10/h1-5H,6H2,(H,9,11) |
| InChIKey | NKRFYXAVEQJMQB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |