C33H35N3O4 — CID 159811461
6-[cyano(ethyl)amino]-5-[3-(4-methoxy-3,3-dimethylbutanoyl)phenyl]-N-methyl-2-(4-methylphenyl)-1-benzofuran-3-carboxamide (PubChem CID 159811461) has the molecular formula C33H35N3O4 and a molecular weight of 537.66 g/mol. Its IUPAC name is 6-[cyano(ethyl)amino]-5-[3-(4-methoxy-3,3-dimethylbutanoyl)phenyl]-N-methyl-2-(4-methylphenyl)-1-benzofuran-3-carboxamide.
| Compound Name | 6-[cyano(ethyl)amino]-5-[3-(4-methoxy-3,3-dimethylbutanoyl)phenyl]-N-methyl-2-(4-methylphenyl)-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 159811461 |
| Molecular Formula | C33H35N3O4 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | 6-[cyano(ethyl)amino]-5-[3-(4-methoxy-3,3-dimethylbutanoyl)phenyl]-N-methyl-2-(4-methylphenyl)-1-benzofuran-3-carboxamide |
| SMILES | CCN(C#N)c1cc2oc(-c3ccc(C)cc3)c(C(=O)NC)c2cc1-c1cccc(C(=O)CC(C)(C)COC)c1 |
| InChI | InChI=1S/C33H35N3O4/c1-7-36(20-34)27-17-29-26(30(32(38)35-5)31(40-29)22-13-11-21(2)12-14-22)16-25(27)23-9-8-10-24(15-23)28(37)18-33(3,4)19-39-6/h8-17H,7,18-19H2,1-6H3,(H,35,38) |
| InChIKey | RXMJTFXLNALURG-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|