C19H21FN2O4 — CID 15981317
3-methylbutyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate (PubChem CID 15981317) has the molecular formula C19H21FN2O4 and a molecular weight of 360.38 g/mol. Its IUPAC name is 3-methylbutyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate.
| Compound Name | 3-methylbutyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate |
|---|---|
| PubChem CID | 15981317 |
| Molecular Formula | C19H21FN2O4 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 3-methylbutyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate |
| SMILES | CC(C)CCOC(=O)COc1ccc(C(=O)Nc2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C19H21FN2O4/c1-13(2)9-10-25-18(23)12-26-17-8-3-14(11-21-17)19(24)22-16-6-4-15(20)5-7-16/h3-8,11,13H,9-10,12H2,1-2H3,(H,22,24) |
| InChIKey | VZNLCSKTOPAQML-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |