C21H16ClFN2O4 — CID 15980829
(4-chlorophenyl)methyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate (PubChem CID 15980829) has the molecular formula C21H16ClFN2O4 and a molecular weight of 414.82 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate.
| Compound Name | (4-chlorophenyl)methyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate |
|---|---|
| PubChem CID | 15980829 |
| Molecular Formula | C21H16ClFN2O4 |
| Molecular Weight | 414.82 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | (4-chlorophenyl)methyl 2-[[5-[(4-fluorophenyl)carbamoyl]-2-pyridinyl]oxy]acetate |
| SMILES | O=C(COc1ccc(C(=O)Nc2ccc(F)cc2)cn1)OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H16ClFN2O4/c22-16-4-1-14(2-5-16)12-29-20(26)13-28-19-10-3-15(11-24-19)21(27)25-18-8-6-17(23)7-9-18/h1-11H,12-13H2,(H,25,27) |
| InChIKey | IHEDDEKMPBOVFI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.82 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |