C12H30N4O3P+ — CID 159816078
N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;1,3,2-dioxaphosphonan-2-ium 2-oxide (PubChem CID 159816078) has the molecular formula C12H30N4O3P+ and a molecular weight of 309.37 g/mol. Its IUPAC name is N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;1,3,2-dioxaphosphonan-2-ium 2-oxide.
| Compound Name | N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;1,3,2-dioxaphosphonan-2-ium 2-oxide |
|---|---|
| PubChem CID | 159816078 |
| Molecular Formula | C12H30N4O3P+ |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;1,3,2-dioxaphosphonan-2-ium 2-oxide |
| SMILES | NCCNCCNCCN.O=[P+]1OCCCCCCO1 |
| InChI | InChI=1S/C6H18N4.C6H12O3P/c7-1-3-9-5-6-10-4-2-8;7-10-8-5-3-1-2-4-6-9-10/h9-10H,1-8H2;1-6H2/q;+1 |
| InChIKey | UWZCFTCHXVTUGG-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|