About CID 159611388
CID 159611388 (PubChem CID 159611388) has the molecular formula C6H16N2NaO3P+
and a molecular weight of 218.17 g/mol.
Molecular Properties
| Compound Name | CID 159611388 |
| PubChem CID | 159611388 |
| Molecular Formula | C6H16N2NaO3P+ |
| Molecular Weight | 218.17 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | — |
| SMILES | CC(N)N.O=[P+]1OCCCCO1.[Na] |
| InChI | InChI=1S/C4H8O3P.C2H8N2.Na/c5-8-6-3-1-2-4-7-8;1-2(3)4;/h1-4H2;2H,3-4H2,1H3;/q+1;; |
| InChIKey | BMXHJPGTUIXQQK-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.17 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 159611388 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159611388?
The IUPAC name of CID 159611388 (CID 159611388) is not available.
What is the SMILES notation for CID 159611388?
The canonical SMILES for CID 159611388 is CC(N)N.O=[P+]1OCCCCO1.[Na].
What is the InChIKey of CID 159611388?
The InChIKey is BMXHJPGTUIXQQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O3P.C2H8N2.Na/c5-8-6-3-1-2-4-7-8;1-2(3)4;/h1-4H2;2H,3-4H2,1H3;/q+1;;.
What are the key properties of CID 159611388?
CID 159611388 has a molecular weight of 218.17 g/mol, XLogP of 0.34, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159611388 is sourced from PubChem (CID 159611388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).