C40H27BO6 — CID 15981790
[(3R,7R,8R,9R)-9-benzoyloxy-5-phenyl-4,6-dioxa-5-borahexacyclo[13.6.2.02,10.03,7.012,22.019,23]tricosa-1(22),2(10),11,13,15(23),16,18,20-octaen-8-yl] benzoate (PubChem CID 15981790) has the molecular formula C40H27BO6 and a molecular weight of 614.46 g/mol. Its IUPAC name is [(3R,7R,8R,9R)-9-benzoyloxy-5-phenyl-4,6-dioxa-5-borahexacyclo[13.6.2.02,10.03,7.012,22.019,23]tricosa-1(22),2(10),11,13,15(23),16,18,20-octaen-8-yl] benzoate.
| Compound Name | [(3R,7R,8R,9R)-9-benzoyloxy-5-phenyl-4,6-dioxa-5-borahexacyclo[13.6.2.02,10.03,7.012,22.019,23]tricosa-1(22),2(10),11,13,15(23),16,18,20-octaen-8-yl] benzoate |
|---|---|
| PubChem CID | 15981790 |
| Molecular Formula | C40H27BO6 |
| Molecular Weight | 614.46 g/mol |
| Exact Mass | 614.19 |
| IUPAC Name | [(3R,7R,8R,9R)-9-benzoyloxy-5-phenyl-4,6-dioxa-5-borahexacyclo[13.6.2.02,10.03,7.012,22.019,23]tricosa-1(22),2(10),11,13,15(23),16,18,20-octaen-8-yl] benzoate |
| SMILES | O=C(O[C@@H]1[C@@H]2OB(c3ccccc3)O[C@@H]2c2c(cc3ccc4cccc5ccc2c3c45)[C@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H27BO6/c42-39(26-11-4-1-5-12-26)44-35-31-23-28-20-19-24-15-10-16-25-21-22-30(33(28)32(24)25)34(31)36-38(47-41(46-36)29-17-8-3-9-18-29)37(35)45-40(43)27-13-6-2-7-14-27/h1-23,35-38H/t35-,36-,37+,38-/m1/s1 |
| InChIKey | QFBLZSQQCVHILQ-UXWDSZNOSA-N |
| XLogP | 7.57 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.46 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|