C40H43NO8Si — CID 102385309
[(1S,5R,6S,7R,8S,9R)-8-[tert-butyl(dimethyl)silyl]oxy-9-[4-(dimethylamino)benzoyl]oxy-3-methyl-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] pyrene-1-carboxylate (PubChem CID 102385309) has the molecular formula C40H43NO8Si and a molecular weight of 693.87 g/mol. Its IUPAC name is [(1S,5R,6S,7R,8S,9R)-8-[tert-butyl(dimethyl)silyl]oxy-9-[4-(dimethylamino)benzoyl]oxy-3-methyl-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] pyrene-1-carboxylate.
| Compound Name | [(1S,5R,6S,7R,8S,9R)-8-[tert-butyl(dimethyl)silyl]oxy-9-[4-(dimethylamino)benzoyl]oxy-3-methyl-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] pyrene-1-carboxylate |
|---|---|
| PubChem CID | 102385309 |
| Molecular Formula | C40H43NO8Si |
| Molecular Weight | 693.87 g/mol |
| Exact Mass | 693.28 |
| IUPAC Name | [(1S,5R,6S,7R,8S,9R)-8-[tert-butyl(dimethyl)silyl]oxy-9-[4-(dimethylamino)benzoyl]oxy-3-methyl-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] pyrene-1-carboxylate |
| SMILES | CN(C)c1ccc(C(=O)O[C@@H]2[C@H]3OC4(C)O[C@H]([C@H]3OC(=O)c3ccc5ccc6cccc7ccc3c5c67)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O4)cc1 |
| InChI | InChI=1S/C40H43NO8Si/c1-39(2,3)50(7,8)49-36-34-31(44-37(42)25-14-18-26(19-15-25)41(5)6)33-32(35(36)48-40(4,46-33)47-34)45-38(43)28-21-17-24-13-12-22-10-9-11-23-16-20-27(28)30(24)29(22)23/h9-21,31-36H,1-8H3/t31-,32+,33-,34+,35-,36+,40?/m1/s1 |
| InChIKey | WKQBBDNPJKNVQE-UQLYITECSA-N |
| XLogP | 7.66 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.87 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|