C25H39NOSi — CID 101155313
4-[(E)-2-[(1R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethenyl]-N,N-dimethylaniline (PubChem CID 101155313) has the molecular formula C25H39NOSi and a molecular weight of 397.68 g/mol. Its IUPAC name is 4-[(E)-2-[(1R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-[(1R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 101155313 |
| Molecular Formula | C25H39NOSi |
| Molecular Weight | 397.68 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | 4-[(E)-2-[(1R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C/C2=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3C[C@@H]2C3(C)C)cc1 |
| InChI | InChI=1S/C25H39NOSi/c1-24(2,3)28(8,9)27-23-16-19(21-17-22(23)25(21,4)5)13-10-18-11-14-20(15-12-18)26(6)7/h10-16,21-23H,17H2,1-9H3/b13-10+/t21-,22+,23-/m0/s1 |
| InChIKey | XNBBWRWULSLIMX-DDEYJURWSA-N |
| XLogP | 6.76 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.68 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|