C21H40O3Si — CID 177383779
(1S,2R,3R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-4-[(2S)-2-hydroxy-3,3-dimethylbutylidene]-6,6-dimethylbicyclo[3.1.1]heptan-3-ol (PubChem CID 177383779) has the molecular formula C21H40O3Si and a molecular weight of 368.63 g/mol. Its IUPAC name is (1S,2R,3R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-4-[(2S)-2-hydroxy-3,3-dimethylbutylidene]-6,6-dimethylbicyclo[3.1.1]heptan-3-ol.
| Compound Name | (1S,2R,3R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-4-[(2S)-2-hydroxy-3,3-dimethylbutylidene]-6,6-dimethylbicyclo[3.1.1]heptan-3-ol |
|---|---|
| PubChem CID | 177383779 |
| Molecular Formula | C21H40O3Si |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | (1S,2R,3R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-4-[(2S)-2-hydroxy-3,3-dimethylbutylidene]-6,6-dimethylbicyclo[3.1.1]heptan-3-ol |
| SMILES | CC(C)(C)[C@@H](O)C=C1[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C21H40O3Si/c1-19(2,3)16(22)11-13-14-12-15(21(14,7)8)18(17(13)23)24-25(9,10)20(4,5)6/h11,14-18,22-23H,12H2,1-10H3/t14-,15+,16-,17+,18+/m0/s1 |
| InChIKey | MVHJMPAFUMLMJU-IGKNDFSCSA-N |
| XLogP | 4.75 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|