C21H40O3Si — CID 101155310
(1R,2R,3S,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-3,3-dimethylbut-1-enyl]-6,6-dimethylbicyclo[3.1.1]heptane-2,3-diol (PubChem CID 101155310) has the molecular formula C21H40O3Si and a molecular weight of 368.63 g/mol. Its IUPAC name is (1R,2R,3S,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-3,3-dimethylbut-1-enyl]-6,6-dimethylbicyclo[3.1.1]heptane-2,3-diol.
| Compound Name | (1R,2R,3S,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-3,3-dimethylbut-1-enyl]-6,6-dimethylbicyclo[3.1.1]heptane-2,3-diol |
|---|---|
| PubChem CID | 101155310 |
| Molecular Formula | C21H40O3Si |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | (1R,2R,3S,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-3,3-dimethylbut-1-enyl]-6,6-dimethylbicyclo[3.1.1]heptane-2,3-diol |
| SMILES | CC(C)(C)/C=C/[C@@]1(O)[C@@H]2C[C@H]([C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O)C2(C)C |
| InChI | InChI=1S/C21H40O3Si/c1-18(2,3)11-12-21(23)15-13-14(20(15,7)8)16(17(21)22)24-25(9,10)19(4,5)6/h11-12,14-17,22-23H,13H2,1-10H3/b12-11+/t14-,15-,16-,17+,21-/m1/s1 |
| InChIKey | DQQFMUSEQBTCES-XOEHTKPMSA-N |
| XLogP | 4.75 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|