C23H36O3Si — CID 11222975
(1S,2R,3R,4Z,5R)-2-[tert-butyl(dimethyl)silyl]oxy-4-[(2S)-2-hydroxy-2-phenylethylidene]-6,6-dimethylbicyclo[3.1.1]heptan-3-ol (PubChem CID 11222975) has the molecular formula C23H36O3Si and a molecular weight of 388.62 g/mol. Its IUPAC name is (1S,2R,3R,4Z,5R)-2-[tert-butyl(dimethyl)silyl]oxy-4-[(2S)-2-hydroxy-2-phenylethylidene]-6,6-dimethylbicyclo[3.1.1]heptan-3-ol.
| Compound Name | (1S,2R,3R,4Z,5R)-2-[tert-butyl(dimethyl)silyl]oxy-4-[(2S)-2-hydroxy-2-phenylethylidene]-6,6-dimethylbicyclo[3.1.1]heptan-3-ol |
|---|---|
| PubChem CID | 11222975 |
| Molecular Formula | C23H36O3Si |
| Molecular Weight | 388.62 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | (1S,2R,3R,4Z,5R)-2-[tert-butyl(dimethyl)silyl]oxy-4-[(2S)-2-hydroxy-2-phenylethylidene]-6,6-dimethylbicyclo[3.1.1]heptan-3-ol |
| SMILES | CC1(C)[C@@H]2C[C@H]1/C(=C/[C@H](O)c1ccccc1)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H36O3Si/c1-22(2,3)27(6,7)26-21-18-14-17(23(18,4)5)16(20(21)25)13-19(24)15-11-9-8-10-12-15/h8-13,17-21,24-25H,14H2,1-7H3/b16-13-/t17-,18+,19-,20+,21+/m0/s1 |
| InChIKey | ZREFMUSBXDDFKT-QMYDRCFBSA-N |
| XLogP | 5.07 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.62 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|