C32H42BrNO2Si — CID 72984682
4-[2-[4-[2-[(4-bromophenyl)methyl]-3-[tert-butyl(dimethyl)silyl]oxypropoxy]phenyl]ethenyl]-N,N-dimethylaniline (PubChem CID 72984682) has the molecular formula C32H42BrNO2Si and a molecular weight of 580.68 g/mol. Its IUPAC name is 4-[2-[4-[2-[(4-bromophenyl)methyl]-3-[tert-butyl(dimethyl)silyl]oxypropoxy]phenyl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[2-[4-[2-[(4-bromophenyl)methyl]-3-[tert-butyl(dimethyl)silyl]oxypropoxy]phenyl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 72984682 |
| Molecular Formula | C32H42BrNO2Si |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | 4-[2-[4-[2-[(4-bromophenyl)methyl]-3-[tert-butyl(dimethyl)silyl]oxypropoxy]phenyl]ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C=Cc2ccc(OCC(CO[Si](C)(C)C(C)(C)C)Cc3ccc(Br)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H42BrNO2Si/c1-32(2,3)37(6,7)36-24-28(22-27-10-16-29(33)17-11-27)23-35-31-20-14-26(15-21-31)9-8-25-12-18-30(19-13-25)34(4)5/h8-21,28H,22-24H2,1-7H3 |
| InChIKey | WZBQYGAQMMIEFA-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|