C15H26BrNO3Si — CID 87214437
2-[(6-bromo-3-pyridinyl)oxymethyl]-3-[tert-butyl(dimethyl)silyl]oxypropan-1-ol (PubChem CID 87214437) has the molecular formula C15H26BrNO3Si and a molecular weight of 376.37 g/mol. Its IUPAC name is 2-[(6-bromo-3-pyridinyl)oxymethyl]-3-[tert-butyl(dimethyl)silyl]oxypropan-1-ol.
| Compound Name | 2-[(6-bromo-3-pyridinyl)oxymethyl]-3-[tert-butyl(dimethyl)silyl]oxypropan-1-ol |
|---|---|
| PubChem CID | 87214437 |
| Molecular Formula | C15H26BrNO3Si |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 2-[(6-bromo-3-pyridinyl)oxymethyl]-3-[tert-butyl(dimethyl)silyl]oxypropan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCC(CO)COc1ccc(Br)nc1 |
| InChI | InChI=1S/C15H26BrNO3Si/c1-15(2,3)21(4,5)20-11-12(9-18)10-19-13-6-7-14(16)17-8-13/h6-8,12,18H,9-11H2,1-5H3 |
| InChIKey | PWNCEMYGDIVEKY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|