C33H39BBr2N6O4 — CID 159821460
5-bromo-1H-indazole;5-bromo-1-(2-methoxyethyl)indazole;1-(2-methoxyethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 159821460) has the molecular formula C33H39BBr2N6O4 and a molecular weight of 754.33 g/mol. Its IUPAC name is 5-bromo-1H-indazole;5-bromo-1-(2-methoxyethyl)indazole;1-(2-methoxyethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 5-bromo-1H-indazole;5-bromo-1-(2-methoxyethyl)indazole;1-(2-methoxyethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 159821460 |
| Molecular Formula | C33H39BBr2N6O4 |
| Molecular Weight | 754.33 g/mol |
| Exact Mass | 752.15 |
| IUPAC Name | 5-bromo-1H-indazole;5-bromo-1-(2-methoxyethyl)indazole;1-(2-methoxyethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | Brc1ccc2[nH]ncc2c1.COCCn1ncc2cc(B3OC(C)(C)C(C)(C)O3)ccc21.COCCn1ncc2cc(Br)ccc21 |
| InChI | InChI=1S/C16H23BN2O3.C10H11BrN2O.C7H5BrN2/c1-15(2)16(3,4)22-17(21-15)13-6-7-14-12(10-13)11-18-19(14)8-9-20-5;1-14-5-4-13-10-3-2-9(11)6-8(10)7-12-13;8-6-1-2-7-5(3-6)4-9-10-7/h6-7,10-11H,8-9H2,1-5H3;2-3,6-7H,4-5H2,1H3;1-4H,(H,9,10) |
| InChIKey | NMHFUAGPVPPWJB-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 101.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.33 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|