C25H22Br2Cl2N2O6 — CID 159823279
1-O-tert-butyl 3-O-methyl 5-bromo-6-chloroindole-1,3-dicarboxylate;methyl 5-bromo-6-chloro-1H-indole-3-carboxylate (PubChem CID 159823279) has the molecular formula C25H22Br2Cl2N2O6 and a molecular weight of 677.17 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-methyl 5-bromo-6-chloroindole-1,3-dicarboxylate;methyl 5-bromo-6-chloro-1H-indole-3-carboxylate.
| Compound Name | 1-O-tert-butyl 3-O-methyl 5-bromo-6-chloroindole-1,3-dicarboxylate;methyl 5-bromo-6-chloro-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 159823279 |
| Molecular Formula | C25H22Br2Cl2N2O6 |
| Molecular Weight | 677.17 g/mol |
| Exact Mass | 673.92 |
| IUPAC Name | 1-O-tert-butyl 3-O-methyl 5-bromo-6-chloroindole-1,3-dicarboxylate;methyl 5-bromo-6-chloro-1H-indole-3-carboxylate |
| SMILES | COC(=O)c1c[nH]c2cc(Cl)c(Br)cc12.COC(=O)c1cn(C(=O)OC(C)(C)C)c2cc(Cl)c(Br)cc12 |
| InChI | InChI=1S/C15H15BrClNO4.C10H7BrClNO2/c1-15(2,3)22-14(20)18-7-9(13(19)21-4)8-5-10(16)11(17)6-12(8)18;1-15-10(14)6-4-13-9-3-8(12)7(11)2-5(6)9/h5-7H,1-4H3;2-4,13H,1H3 |
| InChIKey | NMMXPHMHMBTRBC-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.17 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|