C20H33F3N2O5S — CID 159823620
[5-acetamido-3,4-dimethyl-6-[6-[(2,2,2-trifluoroacetyl)amino]hexylsulfanyl]oxan-2-yl]methyl acetate (PubChem CID 159823620) has the molecular formula C20H33F3N2O5S and a molecular weight of 470.55 g/mol. Its IUPAC name is [5-acetamido-3,4-dimethyl-6-[6-[(2,2,2-trifluoroacetyl)amino]hexylsulfanyl]oxan-2-yl]methyl acetate.
| Compound Name | [5-acetamido-3,4-dimethyl-6-[6-[(2,2,2-trifluoroacetyl)amino]hexylsulfanyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 159823620 |
| Molecular Formula | C20H33F3N2O5S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | [5-acetamido-3,4-dimethyl-6-[6-[(2,2,2-trifluoroacetyl)amino]hexylsulfanyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)NC1C(SCCCCCCNC(=O)C(F)(F)F)OC(COC(C)=O)C(C)C1C |
| InChI | InChI=1S/C20H33F3N2O5S/c1-12-13(2)17(25-14(3)26)18(30-16(12)11-29-15(4)27)31-10-8-6-5-7-9-24-19(28)20(21,22)23/h12-13,16-18H,5-11H2,1-4H3,(H,24,28)(H,25,26) |
| InChIKey | BZFOXCXYDCCKRE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|