C12H24O8 — CID 159826539
1,3-dioxolane;1-(2-methoxyethoxy)propan-2-one;1,3,5-trioxane (PubChem CID 159826539) has the molecular formula C12H24O8 and a molecular weight of 296.32 g/mol. Its IUPAC name is 1,3-dioxolane;1-(2-methoxyethoxy)propan-2-one;1,3,5-trioxane.
| Compound Name | 1,3-dioxolane;1-(2-methoxyethoxy)propan-2-one;1,3,5-trioxane |
|---|---|
| PubChem CID | 159826539 |
| Molecular Formula | C12H24O8 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 1,3-dioxolane;1-(2-methoxyethoxy)propan-2-one;1,3,5-trioxane |
| SMILES | C1COCO1.C1OCOCO1.COCCOCC(C)=O |
| InChI | InChI=1S/C6H12O3.C3H6O3.C3H6O2/c1-6(7)5-9-4-3-8-2;1-4-2-6-3-5-1;1-2-5-3-4-1/h3-5H2,1-2H3;1-3H2;1-3H2 |
| InChIKey | NMXGYUNTJWKDAE-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|