C15H30IN2O- — CID 159826981
methylamino-[(4S)-2-methyl-4-[[[(2R)-4-methyliodanuidylbutan-2-yl]amino]methyl]cyclohexen-1-yl]methanol (PubChem CID 159826981) has the molecular formula C15H30IN2O- and a molecular weight of 381.32 g/mol. Its IUPAC name is methylamino-[(4S)-2-methyl-4-[[[(2R)-4-methyliodanuidylbutan-2-yl]amino]methyl]cyclohexen-1-yl]methanol.
| Compound Name | methylamino-[(4S)-2-methyl-4-[[[(2R)-4-methyliodanuidylbutan-2-yl]amino]methyl]cyclohexen-1-yl]methanol |
|---|---|
| PubChem CID | 159826981 |
| Molecular Formula | C15H30IN2O- |
| Molecular Weight | 381.32 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | methylamino-[(4S)-2-methyl-4-[[[(2R)-4-methyliodanuidylbutan-2-yl]amino]methyl]cyclohexen-1-yl]methanol |
| SMILES | CNC(O)C1=C(C)C[C@@H](CN[C@H](C)CC[I-]C)CC1 |
| InChI | InChI=1S/C15H30IN2O/c1-11-9-13(5-6-14(11)15(19)17-4)10-18-12(2)7-8-16-3/h12-13,15,17-19H,5-10H2,1-4H3/q-1/t12-,13+,15?/m1/s1 |
| InChIKey | SYRFSTCNZAMEBY-NEJHNUGDSA-N |
| XLogP | -1.27 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.32 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|