C14H27NO2S — CID 39782154
(2S)-N-[(1,1-dioxothian-4-yl)methyl]-6-methylhept-5-en-2-amine (PubChem CID 39782154) has the molecular formula C14H27NO2S and a molecular weight of 273.44 g/mol. Its IUPAC name is (2S)-N-[(1,1-dioxothian-4-yl)methyl]-6-methylhept-5-en-2-amine.
| Compound Name | (2S)-N-[(1,1-dioxothian-4-yl)methyl]-6-methylhept-5-en-2-amine |
|---|---|
| PubChem CID | 39782154 |
| Molecular Formula | C14H27NO2S |
| Molecular Weight | 273.44 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | (2S)-N-[(1,1-dioxothian-4-yl)methyl]-6-methylhept-5-en-2-amine |
| SMILES | CC(C)=CCC[C@H](C)NCC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C14H27NO2S/c1-12(2)5-4-6-13(3)15-11-14-7-9-18(16,17)10-8-14/h5,13-15H,4,6-11H2,1-3H3/t13-/m0/s1 |
| InChIKey | VGNOFIWQWBMWNU-ZDUSSCGKSA-N |
| XLogP | 2.54 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|