C39H34F2N6O5 — CID 159828299
tert-butyl 3-(cyanomethyl)-5-(hydroxymethyl)indole-1-carboxylate;6-fluoropyridine-3-carbaldehyde;(Z)-3-(6-fluoro-3-pyridinyl)-2-(5-methoxy-1H-indol-3-yl)prop-2-enenitrile (PubChem CID 159828299) has the molecular formula C39H34F2N6O5 and a molecular weight of 704.73 g/mol. Its IUPAC name is tert-butyl 3-(cyanomethyl)-5-(hydroxymethyl)indole-1-carboxylate;6-fluoropyridine-3-carbaldehyde;(Z)-3-(6-fluoro-3-pyridinyl)-2-(5-methoxy-1H-indol-3-yl)prop-2-enenitrile.
| Compound Name | tert-butyl 3-(cyanomethyl)-5-(hydroxymethyl)indole-1-carboxylate;6-fluoropyridine-3-carbaldehyde;(Z)-3-(6-fluoro-3-pyridinyl)-2-(5-methoxy-1H-indol-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 159828299 |
| Molecular Formula | C39H34F2N6O5 |
| Molecular Weight | 704.73 g/mol |
| Exact Mass | 704.26 |
| IUPAC Name | tert-butyl 3-(cyanomethyl)-5-(hydroxymethyl)indole-1-carboxylate;6-fluoropyridine-3-carbaldehyde;(Z)-3-(6-fluoro-3-pyridinyl)-2-(5-methoxy-1H-indol-3-yl)prop-2-enenitrile |
| SMILES | CC(C)(C)OC(=O)n1cc(CC#N)c2cc(CO)ccc21.COc1ccc2[nH]cc(/C(C#N)=C/c3ccc(F)nc3)c2c1.O=Cc1ccc(F)nc1 |
| InChI | InChI=1S/C17H12FN3O.C16H18N2O3.C6H4FNO/c1-22-13-3-4-16-14(7-13)15(10-20-16)12(8-19)6-11-2-5-17(18)21-9-11;1-16(2,3)21-15(20)18-9-12(6-7-17)13-8-11(10-19)4-5-14(13)18;7-6-2-1-5(4-9)3-8-6/h2-7,9-10,20H,1H3;4-5,8-9,19H,6,10H2,1-3H3;1-4H/b12-6+;; |
| InChIKey | NNDAYRDBRDWNAT-HTFHIHPASA-N |
| XLogP | 7.79 |
| TPSA | 166.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.73 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|