C35H32N2O4 — CID 159828873
2-carbazol-9-ylethyl 2-methylprop-2-enoate;2-carbazol-9-ylethyl prop-2-enoate (PubChem CID 159828873) has the molecular formula C35H32N2O4 and a molecular weight of 544.65 g/mol. Its IUPAC name is 2-carbazol-9-ylethyl 2-methylprop-2-enoate;2-carbazol-9-ylethyl prop-2-enoate.
| Compound Name | 2-carbazol-9-ylethyl 2-methylprop-2-enoate;2-carbazol-9-ylethyl prop-2-enoate |
|---|---|
| PubChem CID | 159828873 |
| Molecular Formula | C35H32N2O4 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | 2-carbazol-9-ylethyl 2-methylprop-2-enoate;2-carbazol-9-ylethyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OCCn1c2ccccc2c2ccccc21.C=CC(=O)OCCn1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C18H17NO2.C17H15NO2/c1-13(2)18(20)21-12-11-19-16-9-5-3-7-14(16)15-8-4-6-10-17(15)19;1-2-17(19)20-12-11-18-15-9-5-3-7-13(15)14-8-4-6-10-16(14)18/h3-10H,1,11-12H2,2H3;2-10H,1,11-12H2 |
| InChIKey | NNEULNSTGUSDNR-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|