C22H27N3O3 — CID 159832595
1-amino-7-methoxy-1-[3-[(3-methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)oxy]phenyl]heptan-3-one (PubChem CID 159832595) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 1-amino-7-methoxy-1-[3-[(3-methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)oxy]phenyl]heptan-3-one.
| Compound Name | 1-amino-7-methoxy-1-[3-[(3-methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)oxy]phenyl]heptan-3-one |
|---|---|
| PubChem CID | 159832595 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 1-amino-7-methoxy-1-[3-[(3-methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)oxy]phenyl]heptan-3-one |
| SMILES | COCCCCC(=O)CC(N)c1cccc(Oc2ccnc3[nH]cc(C)c23)c1 |
| InChI | InChI=1S/C22H27N3O3/c1-15-14-25-22-21(15)20(9-10-24-22)28-18-8-5-6-16(12-18)19(23)13-17(26)7-3-4-11-27-2/h5-6,8-10,12,14,19H,3-4,7,11,13,23H2,1-2H3,(H,24,25) |
| InChIKey | NNQNWPSDLOMBIU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|