C8H13N3O3 — CID 159835751
azanium;3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one;formate (PubChem CID 159835751) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is azanium;3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one;formate.
| Compound Name | azanium;3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one;formate |
|---|---|
| PubChem CID | 159835751 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | azanium;3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one;formate |
| SMILES | O=C[O-].O=c1[nH]cnc2c1CCC2.[NH4+] |
| InChI | InChI=1S/C7H8N2O.CH2O2.H3N/c10-7-5-2-1-3-6(5)8-4-9-7;2-1-3;/h4H,1-3H2,(H,8,9,10);1H,(H,2,3);1H3 |
| InChIKey | BTYDNSOINLQSML-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|