C18H18N2O3 — CID 15984070
ethyl 3,5-dimethyl-4-[(E)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrole-2-carboxylate (PubChem CID 15984070) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is ethyl 3,5-dimethyl-4-[(E)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3,5-dimethyl-4-[(E)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 15984070 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | ethyl 3,5-dimethyl-4-[(E)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(C)c(/C=C2/C(=O)Nc3ccccc32)c1C |
| InChI | InChI=1S/C18H18N2O3/c1-4-23-18(22)16-10(2)13(11(3)19-16)9-14-12-7-5-6-8-15(12)20-17(14)21/h5-9,19H,4H2,1-3H3,(H,20,21)/b14-9+ |
| InChIKey | GUOYZRUSJJQDEC-NTEUORMPSA-N |
| XLogP | 3.30 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|