C13H16ClNO — CID 15984073
(3aS,4R,8bS)-6-chloro-7-methoxy-4-methyl-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrole (PubChem CID 15984073) has the molecular formula C13H16ClNO and a molecular weight of 237.73 g/mol. Its IUPAC name is (3aS,4R,8bS)-6-chloro-7-methoxy-4-methyl-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrole.
| Compound Name | (3aS,4R,8bS)-6-chloro-7-methoxy-4-methyl-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrole |
|---|---|
| PubChem CID | 15984073 |
| Molecular Formula | C13H16ClNO |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | (3aS,4R,8bS)-6-chloro-7-methoxy-4-methyl-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrole |
| SMILES | COc1cc2c(cc1Cl)[C@H](C)[C@@H]1CNC[C@H]21 |
| InChI | InChI=1S/C13H16ClNO/c1-7-8-3-12(14)13(16-2)4-9(8)11-6-15-5-10(7)11/h3-4,7,10-11,15H,5-6H2,1-2H3/t7-,10-,11+/m0/s1 |
| InChIKey | LANLSVUKINPKJD-BKDNQFJXSA-N |
| XLogP | 2.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |