C39H35NO2Si — CID 159841201
6-(2-methyl-7-trimethylsilylspiro[acridine-9,9'-xanthene]-10-yl)-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 159841201) has the molecular formula C39H35NO2Si and a molecular weight of 577.80 g/mol. Its IUPAC name is 6-(2-methyl-7-trimethylsilylspiro[acridine-9,9'-xanthene]-10-yl)-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 6-(2-methyl-7-trimethylsilylspiro[acridine-9,9'-xanthene]-10-yl)-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 159841201 |
| Molecular Formula | C39H35NO2Si |
| Molecular Weight | 577.80 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | 6-(2-methyl-7-trimethylsilylspiro[acridine-9,9'-xanthene]-10-yl)-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | Cc1ccc2c(c1)C1(c3ccccc3Oc3ccccc31)c1cc([Si](C)(C)C)ccc1N2c1ccc2c(c1)CCCC2=O |
| InChI | InChI=1S/C39H35NO2Si/c1-25-16-20-34-32(22-25)39(30-11-5-7-14-37(30)42-38-15-8-6-12-31(38)39)33-24-28(43(2,3)4)18-21-35(33)40(34)27-17-19-29-26(23-27)10-9-13-36(29)41/h5-8,11-12,14-24H,9-10,13H2,1-4H3 |
| InChIKey | FNUWITQVBMLRGM-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.80 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|