C39H33NO3Si — CID 160607697
2-methyl-6-(2-methyl-7-trimethylsilylspiro[acridine-9,9'-xanthene]-10-yl)chromen-4-one (PubChem CID 160607697) has the molecular formula C39H33NO3Si and a molecular weight of 591.78 g/mol. Its IUPAC name is 2-methyl-6-(2-methyl-7-trimethylsilylspiro[acridine-9,9'-xanthene]-10-yl)chromen-4-one.
| Compound Name | 2-methyl-6-(2-methyl-7-trimethylsilylspiro[acridine-9,9'-xanthene]-10-yl)chromen-4-one |
|---|---|
| PubChem CID | 160607697 |
| Molecular Formula | C39H33NO3Si |
| Molecular Weight | 591.78 g/mol |
| Exact Mass | 591.22 |
| IUPAC Name | 2-methyl-6-(2-methyl-7-trimethylsilylspiro[acridine-9,9'-xanthene]-10-yl)chromen-4-one |
| SMILES | Cc1ccc2c(c1)C1(c3ccccc3Oc3ccccc31)c1cc([Si](C)(C)C)ccc1N2c1ccc2oc(C)cc(=O)c2c1 |
| InChI | InChI=1S/C39H33NO3Si/c1-24-14-17-33-31(20-24)39(29-10-6-8-12-37(29)43-38-13-9-7-11-30(38)39)32-23-27(44(3,4)5)16-18-34(32)40(33)26-15-19-36-28(22-26)35(41)21-25(2)42-36/h6-23H,1-5H3 |
| InChIKey | IHHNNQPGZQLVJR-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.78 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|