C27H42N11O4+ — CID 159841241
7-tert-butyl-3,9-dimethyl-1,4,5a,9a-tetrahydropurino[8,7-c][1,2,4]triazine-6,8-dione;4-tert-butyl-6,12-dimethyl-4,6,10,11-tetraza-1-azoniatricyclo[7.4.0.02,7]trideca-1(9),11-diene-3,5-dione (PubChem CID 159841241) has the molecular formula C27H42N11O4+ and a molecular weight of 584.71 g/mol. Its IUPAC name is 7-tert-butyl-3,9-dimethyl-1,4,5a,9a-tetrahydropurino[8,7-c][1,2,4]triazine-6,8-dione;4-tert-butyl-6,12-dimethyl-4,6,10,11-tetraza-1-azoniatricyclo[7.4.0.02,7]trideca-1(9),11-diene-3,5-dione.
| Compound Name | 7-tert-butyl-3,9-dimethyl-1,4,5a,9a-tetrahydropurino[8,7-c][1,2,4]triazine-6,8-dione;4-tert-butyl-6,12-dimethyl-4,6,10,11-tetraza-1-azoniatricyclo[7.4.0.02,7]trideca-1(9),11-diene-3,5-dione |
|---|---|
| PubChem CID | 159841241 |
| Molecular Formula | C27H42N11O4+ |
| Molecular Weight | 584.71 g/mol |
| Exact Mass | 584.34 |
| IUPAC Name | 7-tert-butyl-3,9-dimethyl-1,4,5a,9a-tetrahydropurino[8,7-c][1,2,4]triazine-6,8-dione;4-tert-butyl-6,12-dimethyl-4,6,10,11-tetraza-1-azoniatricyclo[7.4.0.02,7]trideca-1(9),11-diene-3,5-dione |
| SMILES | CC1=NNC2=NC3C(C(=O)N(C(C)(C)C)C(=O)N3C)N2C1.CC1=NNC2=[N+](C1)C1C(=O)N(C(C)(C)C)C(=O)N(C)C1C2 |
| InChI | InChI=1S/C14H21N5O2.C13H20N6O2/c1-8-7-18-10(16-15-8)6-9-11(18)12(20)19(14(2,3)4)13(21)17(9)5;1-7-6-18-8-9(14-11(18)16-15-7)17(5)12(21)19(10(8)20)13(2,3)4/h9,11H,6-7H2,1-5H3;8-9H,6H2,1-5H3,(H,14,16)/p+1 |
| InChIKey | NPLIIUAZWYLTOU-UHFFFAOYSA-O |
| XLogP | 0.23 |
| TPSA | 148.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.71 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|