C24H39N8O2+ — CID 73326816
3,4,9-trimethyl-1,7-bis(2-piperidin-1-ylethyl)-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione (PubChem CID 73326816) has the molecular formula C24H39N8O2+ and a molecular weight of 471.63 g/mol. Its IUPAC name is 3,4,9-trimethyl-1,7-bis(2-piperidin-1-ylethyl)-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione.
| Compound Name | 3,4,9-trimethyl-1,7-bis(2-piperidin-1-ylethyl)-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
|---|---|
| PubChem CID | 73326816 |
| Molecular Formula | C24H39N8O2+ |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.32 |
| IUPAC Name | 3,4,9-trimethyl-1,7-bis(2-piperidin-1-ylethyl)-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
| SMILES | CC1=NN(CCN2CCCCC2)C2=[N+](C1C)C1C(=O)N(CCN3CCCCC3)C(=O)N(C)C1=N2 |
| InChI | InChI=1S/C24H39N8O2/c1-18-19(2)32-20-21(25-23(32)31(26-18)17-15-29-12-8-5-9-13-29)27(3)24(34)30(22(20)33)16-14-28-10-6-4-7-11-28/h19-20H,4-17H2,1-3H3/q+1 |
| InChIKey | MOAPMZUXTXDVMX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 78.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|