C21H33N8O4+ — CID 73329038
3,9-dimethyl-1,7-bis(2-morpholin-4-ylethyl)-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione (PubChem CID 73329038) has the molecular formula C21H33N8O4+ and a molecular weight of 461.55 g/mol. Its IUPAC name is 3,9-dimethyl-1,7-bis(2-morpholin-4-ylethyl)-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione.
| Compound Name | 3,9-dimethyl-1,7-bis(2-morpholin-4-ylethyl)-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
|---|---|
| PubChem CID | 73329038 |
| Molecular Formula | C21H33N8O4+ |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | 3,9-dimethyl-1,7-bis(2-morpholin-4-ylethyl)-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
| SMILES | CC1=NN(CCN2CCOCC2)C2=[N+](C1)C1C(=O)N(CCN3CCOCC3)C(=O)N(C)C1=N2 |
| InChI | InChI=1S/C21H33N8O4/c1-16-15-28-17-18(22-20(28)29(23-16)6-4-26-9-13-33-14-10-26)24(2)21(31)27(19(17)30)5-3-25-7-11-32-12-8-25/h17H,3-15H2,1-2H3/q+1 |
| InChIKey | XKICYEAPTINBOB-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 96.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|