C19H30N7O3+ — CID 73326806
3-tert-butyl-7,9-dimethyl-1-(2-morpholin-4-ylethyl)-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione (PubChem CID 73326806) has the molecular formula C19H30N7O3+ and a molecular weight of 404.50 g/mol. Its IUPAC name is 3-tert-butyl-7,9-dimethyl-1-(2-morpholin-4-ylethyl)-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione.
| Compound Name | 3-tert-butyl-7,9-dimethyl-1-(2-morpholin-4-ylethyl)-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
|---|---|
| PubChem CID | 73326806 |
| Molecular Formula | C19H30N7O3+ |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 3-tert-butyl-7,9-dimethyl-1-(2-morpholin-4-ylethyl)-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
| SMILES | CN1C(=O)C2C(=NC3=[N+]2CC(C(C)(C)C)=NN3CCN2CCOCC2)N(C)C1=O |
| InChI | InChI=1S/C19H30N7O3/c1-19(2,3)13-12-25-14-15(22(4)18(28)23(5)16(14)27)20-17(25)26(21-13)7-6-24-8-10-29-11-9-24/h14H,6-12H2,1-5H3/q+1 |
| InChIKey | RRGPBIMFEODHBR-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 84.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|