C17H25N6O4+ — CID 73328000
ethyl 2-(7-butyl-3,9-dimethyl-6,8-dioxo-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-1-yl)acetate (PubChem CID 73328000) has the molecular formula C17H25N6O4+ and a molecular weight of 377.43 g/mol. Its IUPAC name is ethyl 2-(7-butyl-3,9-dimethyl-6,8-dioxo-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-1-yl)acetate.
| Compound Name | ethyl 2-(7-butyl-3,9-dimethyl-6,8-dioxo-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-1-yl)acetate |
|---|---|
| PubChem CID | 73328000 |
| Molecular Formula | C17H25N6O4+ |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | ethyl 2-(7-butyl-3,9-dimethyl-6,8-dioxo-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-1-yl)acetate |
| SMILES | CCCCN1C(=O)C2C(=NC3=[N+]2CC(C)=NN3CC(=O)OCC)N(C)C1=O |
| InChI | InChI=1S/C17H25N6O4/c1-5-7-8-21-15(25)13-14(20(4)17(21)26)18-16-22(13)9-11(3)19-23(16)10-12(24)27-6-2/h13H,5-10H2,1-4H3/q+1 |
| InChIKey | SDVARINKAGNSHQ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 97.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|