C18H28N5O5+ — CID 74443846
ethyl 2-[8-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetate (PubChem CID 74443846) has the molecular formula C18H28N5O5+ and a molecular weight of 394.45 g/mol. Its IUPAC name is ethyl 2-[8-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetate.
| Compound Name | ethyl 2-[8-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetate |
|---|---|
| PubChem CID | 74443846 |
| Molecular Formula | C18H28N5O5+ |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | ethyl 2-[8-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetate |
| SMILES | CCOC(=O)C[N+]1=C(CN2CC(C)OC(C)C2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C18H28N5O5/c1-6-27-14(24)10-23-13(9-22-7-11(2)28-12(3)8-22)19-16-15(23)17(25)21(5)18(26)20(16)4/h11-12,15H,6-10H2,1-5H3/q+1 |
| InChIKey | LOLDACQFVUVYEC-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 94.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|