C14H23ClN5O4+ — CID 73326983
7-(2-hydroxy-3-morpholin-4-ylpropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione;hydrochloride (PubChem CID 73326983) has the molecular formula C14H23ClN5O4+ and a molecular weight of 360.82 g/mol. Its IUPAC name is 7-(2-hydroxy-3-morpholin-4-ylpropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione;hydrochloride.
| Compound Name | 7-(2-hydroxy-3-morpholin-4-ylpropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 73326983 |
| Molecular Formula | C14H23ClN5O4+ |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 7-(2-hydroxy-3-morpholin-4-ylpropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione;hydrochloride |
| SMILES | CN1C(=O)C2C(=NC=[N+]2CC(O)CN2CCOCC2)N(C)C1=O.Cl |
| InChI | InChI=1S/C14H22N5O4.ClH/c1-16-12-11(13(21)17(2)14(16)22)19(9-15-12)8-10(20)7-18-3-5-23-6-4-18;/h9-11,20H,3-8H2,1-2H3;1H/q+1; |
| InChIKey | LNASVGQHKZNBQE-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|