C13H22N5O4+ — CID 73185868
7-[2-hydroxy-3-[2-hydroxyethyl(methyl)amino]propyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 73185868) has the molecular formula C13H22N5O4+ and a molecular weight of 312.35 g/mol. Its IUPAC name is 7-[2-hydroxy-3-[2-hydroxyethyl(methyl)amino]propyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-[2-hydroxy-3-[2-hydroxyethyl(methyl)amino]propyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 73185868 |
| Molecular Formula | C13H22N5O4+ |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 7-[2-hydroxy-3-[2-hydroxyethyl(methyl)amino]propyl]-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CN(CCO)CC(O)C[N+]1=CN=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C13H22N5O4/c1-15(4-5-19)6-9(20)7-18-8-14-11-10(18)12(21)17(3)13(22)16(11)2/h8-10,19-20H,4-7H2,1-3H3/q+1 |
| InChIKey | KVUBPMMJLSMNPF-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|