C9H11N4O3+ — CID 72732235
2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetaldehyde (PubChem CID 72732235) has the molecular formula C9H11N4O3+ and a molecular weight of 223.21 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetaldehyde.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetaldehyde |
|---|---|
| PubChem CID | 72732235 |
| Molecular Formula | C9H11N4O3+ |
| Molecular Weight | 223.21 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetaldehyde |
| SMILES | CN1C(=O)C2C(=NC=[N+]2CC=O)N(C)C1=O |
| InChI | InChI=1S/C9H11N4O3/c1-11-7-6(8(15)12(2)9(11)16)13(3-4-14)5-10-7/h4-6H,3H2,1-2H3/q+1 |
| InChIKey | URPNPCFZXVCHJF-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.21 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|